C20H23N3O6 — CID 171978716
ethyl 5-[(2-benzamidoacetyl)oxymethyl]-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 171978716) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is ethyl 5-[(2-benzamidoacetyl)oxymethyl]-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-[(2-benzamidoacetyl)oxymethyl]-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 171978716 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl 5-[(2-benzamidoacetyl)oxymethyl]-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(COC(=O)CNC(=O)c2ccccc2)c(/C(C)=N/O)c1C |
| InChI | InChI=1S/C20H23N3O6/c1-4-28-20(26)18-12(2)17(13(3)23-27)15(22-18)11-29-16(24)10-21-19(25)14-8-6-5-7-9-14/h5-9,22,27H,4,10-11H2,1-3H3,(H,21,25)/b23-13+ |
| InChIKey | IJTXQVIQBSGJCZ-YDZHTSKRSA-N |
| XLogP | 2.17 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|