C22H28N2O9S — CID 3934324
diethyl 5-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 3934324) has the molecular formula C22H28N2O9S and a molecular weight of 496.54 g/mol. Its IUPAC name is diethyl 5-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3934324 |
| Molecular Formula | C22H28N2O9S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | diethyl 5-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(COC(=O)C(C)NS(=O)(=O)c2ccc(OC)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H28N2O9S/c1-6-31-21(26)18-13(3)19(22(27)32-7-2)23-17(18)12-33-20(25)14(4)24-34(28,29)16-10-8-15(30-5)9-11-16/h8-11,14,23-24H,6-7,12H2,1-5H3 |
| InChIKey | OSLJGRKGQUZFMJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 150.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|