C22H31ClN2O4 — CID 43001087
diethyl 3-methyl-5-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-1H-pyrrole-2,4-dicarboxylate chloride (PubChem CID 43001087) has the molecular formula C22H31ClN2O4 and a molecular weight of 422.95 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-1H-pyrrole-2,4-dicarboxylate chloride.
| Compound Name | diethyl 3-methyl-5-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-1H-pyrrole-2,4-dicarboxylate chloride |
|---|---|
| PubChem CID | 43001087 |
| Molecular Formula | C22H31ClN2O4 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | diethyl 3-methyl-5-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-1H-pyrrole-2,4-dicarboxylate chloride |
| SMILES | CCOC(=O)c1[nH]c(C[n+]2ccc(C(CC)CC)cc2)c(C(=O)OCC)c1C.[Cl-] |
| InChI | InChI=1S/C22H30N2O4.ClH/c1-6-16(7-2)17-10-12-24(13-11-17)14-18-19(21(25)27-8-3)15(5)20(23-18)22(26)28-9-4;/h10-13,16H,6-9,14H2,1-5H3;1H |
| InChIKey | BSJVSEUPLBKTFQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|