About 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium
1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium (PubChem CID 134910243) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium.
Molecular Properties
| Compound Name | 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium |
| PubChem CID | 134910243 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium |
| SMILES | [O-][N+]1=CN(O)C2C=CC=CC21 |
| InChI | InChI=1S/C7H8N2O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-7,10H |
| InChIKey | YJZNYUCMOJIKTB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium?
The IUPAC name of 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium (CID 134910243) is 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium.
What is the SMILES notation for 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium?
The canonical SMILES for 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium is [O-][N+]1=CN(O)C2C=CC=CC21.
What is the InChIKey of 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium?
The InChIKey is YJZNYUCMOJIKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-7,10H.
What are the key properties of 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium?
1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium has a molecular weight of 152.15 g/mol, XLogP of 0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium is sourced from PubChem (CID 134910243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).