C9H12N2O2 — CID 134989878
2-ethyl-1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium (PubChem CID 134989878) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-ethyl-1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium.
| Compound Name | 2-ethyl-1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium |
|---|---|
| PubChem CID | 134989878 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-ethyl-1-hydroxy-3-oxido-3a,7a-dihydrobenzimidazol-3-ium |
| SMILES | CCC1=[N+]([O-])C2C=CC=CC2N1O |
| InChI | InChI=1S/C9H12N2O2/c1-2-9-10(12)7-5-3-4-6-8(7)11(9)13/h3-8,12H,2H2,1H3 |
| InChIKey | NFCUBFWOSCNLDV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|