C8H10N2O2 — CID 134989802
1-hydroxy-2-methyl-3-oxido-3a,7a-dihydrobenzimidazol-3-ium (PubChem CID 134989802) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-hydroxy-2-methyl-3-oxido-3a,7a-dihydrobenzimidazol-3-ium.
| Compound Name | 1-hydroxy-2-methyl-3-oxido-3a,7a-dihydrobenzimidazol-3-ium |
|---|---|
| PubChem CID | 134989802 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-hydroxy-2-methyl-3-oxido-3a,7a-dihydrobenzimidazol-3-ium |
| SMILES | CC1=[N+]([O-])C2C=CC=CC2N1O |
| InChI | InChI=1S/C8H10N2O2/c1-6-9(11)7-4-2-3-5-8(7)10(6)12/h2-5,7-8,11H,1H3 |
| InChIKey | BPHWKVSKLITJGW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|