C13H24N2V — CID 158623767
1,2-dimethyl-3a,7a-dihydrobenzimidazole;ethane;vanadium (PubChem CID 158623767) has the molecular formula C13H24N2V and a molecular weight of 259.29 g/mol. Its IUPAC name is 1,2-dimethyl-3a,7a-dihydrobenzimidazole;ethane;vanadium.
| Compound Name | 1,2-dimethyl-3a,7a-dihydrobenzimidazole;ethane;vanadium |
|---|---|
| PubChem CID | 158623767 |
| Molecular Formula | C13H24N2V |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1,2-dimethyl-3a,7a-dihydrobenzimidazole;ethane;vanadium |
| SMILES | CC.CC.CC1=NC2C=CC=CC2N1C.[V] |
| InChI | InChI=1S/C9H12N2.2C2H6.V/c1-7-10-8-5-3-4-6-9(8)11(7)2;2*1-2;/h3-6,8-9H,1-2H3;2*1-2H3; |
| InChIKey | HYIDWSLBXTWUBV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |