C22H13NO3 — CID 134911854
3,7-diphenylchromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 134911854) has the molecular formula C22H13NO3 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3,7-diphenylchromeno[3,4-d][1,2]oxazol-4-one.
| Compound Name | 3,7-diphenylchromeno[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 134911854 |
| Molecular Formula | C22H13NO3 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3,7-diphenylchromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | O=c1oc2cc(-c3ccccc3)ccc2c2onc(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H13NO3/c24-22-19-20(15-9-5-2-6-10-15)23-26-21(19)17-12-11-16(13-18(17)25-22)14-7-3-1-4-8-14/h1-13H |
| InChIKey | XTUKZSRULFIGIR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|