C20H22ClNO4 — CID 134913357
methyl 3-chloro-1-(3,4-dimethoxyphenyl)-4-methyl-5,6,7,8-tetrahydroisoquinoline-6-carboxylate (PubChem CID 134913357) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is methyl 3-chloro-1-(3,4-dimethoxyphenyl)-4-methyl-5,6,7,8-tetrahydroisoquinoline-6-carboxylate.
| Compound Name | methyl 3-chloro-1-(3,4-dimethoxyphenyl)-4-methyl-5,6,7,8-tetrahydroisoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 134913357 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | methyl 3-chloro-1-(3,4-dimethoxyphenyl)-4-methyl-5,6,7,8-tetrahydroisoquinoline-6-carboxylate |
| SMILES | COC(=O)C1CCc2c(-c3ccc(OC)c(OC)c3)nc(Cl)c(C)c2C1 |
| InChI | InChI=1S/C20H22ClNO4/c1-11-15-9-13(20(23)26-4)5-7-14(15)18(22-19(11)21)12-6-8-16(24-2)17(10-12)25-3/h6,8,10,13H,5,7,9H2,1-4H3 |
| InChIKey | WDACVCKKPQTSFD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|