C21H20NO4+ — CID 134913777
diethyl 2-phenylisoquinolin-2-ium-3,4-dicarboxylate (PubChem CID 134913777) has the molecular formula C21H20NO4+ and a molecular weight of 350.39 g/mol. Its IUPAC name is diethyl 2-phenylisoquinolin-2-ium-3,4-dicarboxylate.
| Compound Name | diethyl 2-phenylisoquinolin-2-ium-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134913777 |
| Molecular Formula | C21H20NO4+ |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | diethyl 2-phenylisoquinolin-2-ium-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)[n+](-c2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C21H20NO4/c1-3-25-20(23)18-17-13-9-8-10-15(17)14-22(16-11-6-5-7-12-16)19(18)21(24)26-4-2/h5-14H,3-4H2,1-2H3/q+1 |
| InChIKey | VKDCEYDBWNZMAH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|