C21H22NO3+ — CID 139256166
ethyl 2-(4-methoxyphenyl)-1,3-dimethylisoquinolin-2-ium-4-carboxylate (PubChem CID 139256166) has the molecular formula C21H22NO3+ and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)-1,3-dimethylisoquinolin-2-ium-4-carboxylate.
| Compound Name | ethyl 2-(4-methoxyphenyl)-1,3-dimethylisoquinolin-2-ium-4-carboxylate |
|---|---|
| PubChem CID | 139256166 |
| Molecular Formula | C21H22NO3+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)-1,3-dimethylisoquinolin-2-ium-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)[n+](-c2ccc(OC)cc2)c(C)c2ccccc12 |
| InChI | InChI=1S/C21H22NO3/c1-5-25-21(23)20-15(3)22(16-10-12-17(24-4)13-11-16)14(2)18-8-6-7-9-19(18)20/h6-13H,5H2,1-4H3/q+1 |
| InChIKey | XEZYGWLUQINJQY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|