C24H25NO4 — CID 134913831
ethyl 5-[ethoxy(phenyl)methyl]-1-methyl-6-oxo-2-phenylpyridine-3-carboxylate (PubChem CID 134913831) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 5-[ethoxy(phenyl)methyl]-1-methyl-6-oxo-2-phenylpyridine-3-carboxylate.
| Compound Name | ethyl 5-[ethoxy(phenyl)methyl]-1-methyl-6-oxo-2-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 134913831 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | ethyl 5-[ethoxy(phenyl)methyl]-1-methyl-6-oxo-2-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(OCC)c2ccccc2)c(=O)n(C)c1-c1ccccc1 |
| InChI | InChI=1S/C24H25NO4/c1-4-28-22(18-14-10-7-11-15-18)20-16-19(24(27)29-5-2)21(25(3)23(20)26)17-12-8-6-9-13-17/h6-16,22H,4-5H2,1-3H3 |
| InChIKey | KRAYYRQVOWQCEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |