C11H19F3N2O3SSi — CID 134913925
N,N-dimethyl-1-trimethylsilylpyridin-1-ium-4-amine;trifluoromethanesulfonate (PubChem CID 134913925) has the molecular formula C11H19F3N2O3SSi and a molecular weight of 344.43 g/mol. Its IUPAC name is N,N-dimethyl-1-trimethylsilylpyridin-1-ium-4-amine;trifluoromethanesulfonate.
| Compound Name | N,N-dimethyl-1-trimethylsilylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134913925 |
| Molecular Formula | C11H19F3N2O3SSi |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N,N-dimethyl-1-trimethylsilylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
| SMILES | CN(C)c1cc[n+]([Si](C)(C)C)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H19N2Si.CHF3O3S/c1-11(2)10-6-8-12(9-7-10)13(3,4)5;2-1(3,4)8(5,6)7/h6-9H,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | APLQRJULHVAMOT-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|