molecular iodine;selenoxanthen-9-one

C13H8I2OSe — CID 134913960

IUPACmolecular iodine;selenoxanthen-9-one
SMILESII.O=c1c2ccccc2[se]c2ccccc12
InChIInChI=1S/C13H8OSe.I2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2/h1-8H;
InChIKeyXDYFQRMUSCVQKN-UHFFFAOYSA-N
MW512.97 g/mol
LogP4.18
Rot. Bonds

About molecular iodine;selenoxanthen-9-one

molecular iodine;selenoxanthen-9-one (PubChem CID 134913960) has the molecular formula C13H8I2OSe and a molecular weight of 512.97 g/mol. Its IUPAC name is molecular iodine;selenoxanthen-9-one.

Molecular Properties

Compound Namemolecular iodine;selenoxanthen-9-one
PubChem CID134913960
Molecular FormulaC13H8I2OSe
Molecular Weight512.97 g/mol
Exact Mass513.78
IUPAC Namemolecular iodine;selenoxanthen-9-one
SMILESII.O=c1c2ccccc2[se]c2ccccc12
InChIInChI=1S/C13H8OSe.I2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2/h1-8H;
InChIKeyXDYFQRMUSCVQKN-UHFFFAOYSA-N
XLogP4.18
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500512.97
LogP ≤ 54.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze molecular iodine;selenoxanthen-9-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular iodine;selenoxanthen-9-one?
The IUPAC name of molecular iodine;selenoxanthen-9-one (CID 134913960) is molecular iodine;selenoxanthen-9-one.
What is the SMILES notation for molecular iodine;selenoxanthen-9-one?
The canonical SMILES for molecular iodine;selenoxanthen-9-one is II.O=c1c2ccccc2[se]c2ccccc12.
What is the InChIKey of molecular iodine;selenoxanthen-9-one?
The InChIKey is XDYFQRMUSCVQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OSe.I2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2/h1-8H;.
What are the key properties of molecular iodine;selenoxanthen-9-one?
molecular iodine;selenoxanthen-9-one has a molecular weight of 512.97 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;selenoxanthen-9-one is sourced from PubChem (CID 134913960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).