About molecular iodine;selenoxanthen-9-one
molecular iodine;selenoxanthen-9-one (PubChem CID 134913960) has the molecular formula C13H8I2OSe
and a molecular weight of 512.97 g/mol. Its IUPAC name is molecular iodine;selenoxanthen-9-one.
Molecular Properties
| Compound Name | molecular iodine;selenoxanthen-9-one |
| PubChem CID | 134913960 |
| Molecular Formula | C13H8I2OSe |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 513.78 |
| IUPAC Name | molecular iodine;selenoxanthen-9-one |
| SMILES | II.O=c1c2ccccc2[se]c2ccccc12 |
| InChI | InChI=1S/C13H8OSe.I2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2/h1-8H; |
| InChIKey | XDYFQRMUSCVQKN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze molecular iodine;selenoxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular iodine;selenoxanthen-9-one?
The IUPAC name of molecular iodine;selenoxanthen-9-one (CID 134913960) is molecular iodine;selenoxanthen-9-one.
What is the SMILES notation for molecular iodine;selenoxanthen-9-one?
The canonical SMILES for molecular iodine;selenoxanthen-9-one is II.O=c1c2ccccc2[se]c2ccccc12.
What is the InChIKey of molecular iodine;selenoxanthen-9-one?
The InChIKey is XDYFQRMUSCVQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OSe.I2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2/h1-8H;.
What are the key properties of molecular iodine;selenoxanthen-9-one?
molecular iodine;selenoxanthen-9-one has a molecular weight of 512.97 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;selenoxanthen-9-one is sourced from PubChem (CID 134913960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).