C11H8OSe — CID 134909110
2,3-dihydrocyclopenta[b][1]benzoselenol-1-one (PubChem CID 134909110) has the molecular formula C11H8OSe and a molecular weight of 235.14 g/mol. Its IUPAC name is 2,3-dihydrocyclopenta[b][1]benzoselenol-1-one.
| Compound Name | 2,3-dihydrocyclopenta[b][1]benzoselenol-1-one |
|---|---|
| PubChem CID | 134909110 |
| Molecular Formula | C11H8OSe |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2,3-dihydrocyclopenta[b][1]benzoselenol-1-one |
| SMILES | O=C1CCc2[se]c3ccccc3c21 |
| InChI | InChI=1S/C11H8OSe/c12-8-5-6-10-11(8)7-3-1-2-4-9(7)13-10/h1-4H,5-6H2 |
| InChIKey | DDKXQHPCTIRRAO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|