About 4-phenyltriazin-1-ium tetrafluoroborate
4-phenyltriazin-1-ium tetrafluoroborate (PubChem CID 134916061) has the molecular formula C9H8BF4N3
and a molecular weight of 244.99 g/mol. Its IUPAC name is 4-phenyltriazin-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 4-phenyltriazin-1-ium tetrafluoroborate |
| PubChem CID | 134916061 |
| Molecular Formula | C9H8BF4N3 |
| Molecular Weight | 244.99 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-phenyltriazin-1-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(-c2cc[nH+]nn2)cc1 |
| InChI | InChI=1S/C9H7N3.BF4/c1-2-4-8(5-3-1)9-6-7-10-12-11-9;2-1(3,4)5/h1-7H;/q;-1/p+1 |
| InChIKey | PTTZPDBLCOORDC-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.99 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyltriazin-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyltriazin-1-ium tetrafluoroborate?
The IUPAC name of 4-phenyltriazin-1-ium tetrafluoroborate (CID 134916061) is 4-phenyltriazin-1-ium tetrafluoroborate.
What is the SMILES notation for 4-phenyltriazin-1-ium tetrafluoroborate?
The canonical SMILES for 4-phenyltriazin-1-ium tetrafluoroborate is F[B-](F)(F)F.c1ccc(-c2cc[nH+]nn2)cc1.
What is the InChIKey of 4-phenyltriazin-1-ium tetrafluoroborate?
The InChIKey is PTTZPDBLCOORDC-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7N3.BF4/c1-2-4-8(5-3-1)9-6-7-10-12-11-9;2-1(3,4)5/h1-7H;/q;-1/p+1.
What are the key properties of 4-phenyltriazin-1-ium tetrafluoroborate?
4-phenyltriazin-1-ium tetrafluoroborate has a molecular weight of 244.99 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyltriazin-1-ium tetrafluoroborate is sourced from PubChem (CID 134916061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).