C18H19NO2S — CID 134916149
ethyl 3-benzyl-3,4-dihydro-2H-1,4-benzothiazine-2-carboxylate (PubChem CID 134916149) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is ethyl 3-benzyl-3,4-dihydro-2H-1,4-benzothiazine-2-carboxylate.
| Compound Name | ethyl 3-benzyl-3,4-dihydro-2H-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 134916149 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl 3-benzyl-3,4-dihydro-2H-1,4-benzothiazine-2-carboxylate |
| SMILES | CCOC(=O)C1Sc2ccccc2NC1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2S/c1-2-21-18(20)17-15(12-13-8-4-3-5-9-13)19-14-10-6-7-11-16(14)22-17/h3-11,15,17,19H,2,12H2,1H3 |
| InChIKey | WGIRKXVUGNYRNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |