C28H45NO4S — CID 134916202
ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]-2-methylheptanoate (PubChem CID 134916202) has the molecular formula C28H45NO4S and a molecular weight of 491.74 g/mol. Its IUPAC name is ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]-2-methylheptanoate.
| Compound Name | ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]-2-methylheptanoate |
|---|---|
| PubChem CID | 134916202 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]-2-methylheptanoate |
| SMILES | CCOC(=O)C(C)CCCCCC1Nc2ccccc2SC1CCCCCC(C)C(=O)OCC |
| InChI | InChI=1S/C28H45NO4S/c1-5-32-27(30)21(3)15-9-7-11-17-23-25(34-26-20-14-13-18-24(26)29-23)19-12-8-10-16-22(4)28(31)33-6-2/h13-14,18,20-23,25,29H,5-12,15-17,19H2,1-4H3 |
| InChIKey | XHNRXVHRRFKRKA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|