C20H31NO3S — CID 156587775
2-ethylheptyl 3-(2-acetamidophenyl)sulfanylpropanoate (PubChem CID 156587775) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is 2-ethylheptyl 3-(2-acetamidophenyl)sulfanylpropanoate.
| Compound Name | 2-ethylheptyl 3-(2-acetamidophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 156587775 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-ethylheptyl 3-(2-acetamidophenyl)sulfanylpropanoate |
| SMILES | CCCCCC(CC)COC(=O)CCSc1ccccc1NC(C)=O |
| InChI | InChI=1S/C20H31NO3S/c1-4-6-7-10-17(5-2)15-24-20(23)13-14-25-19-12-9-8-11-18(19)21-16(3)22/h8-9,11-12,17H,4-7,10,13-15H2,1-3H3,(H,21,22) |
| InChIKey | OVGHIIHNCFETMD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|