C28H43NO4S — CID 134870071
ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-4H-1,4-benzothiazin-3-yl]-2-methylheptanoate (PubChem CID 134870071) has the molecular formula C28H43NO4S and a molecular weight of 489.72 g/mol. Its IUPAC name is ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-4H-1,4-benzothiazin-3-yl]-2-methylheptanoate.
| Compound Name | ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-4H-1,4-benzothiazin-3-yl]-2-methylheptanoate |
|---|---|
| PubChem CID | 134870071 |
| Molecular Formula | C28H43NO4S |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | ethyl 7-[2-(7-ethoxy-6-methyl-7-oxoheptyl)-4H-1,4-benzothiazin-3-yl]-2-methylheptanoate |
| SMILES | CCOC(=O)C(C)CCCCCC1=C(CCCCCC(C)C(=O)OCC)Sc2ccccc2N1 |
| InChI | InChI=1S/C28H43NO4S/c1-5-32-27(30)21(3)15-9-7-11-17-23-25(34-26-20-14-13-18-24(26)29-23)19-12-8-10-16-22(4)28(31)33-6-2/h13-14,18,20-22,29H,5-12,15-17,19H2,1-4H3 |
| InChIKey | NMKCBPNKULAELG-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|