C24H25NO2S — CID 134956611
ethyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-3-phenylpropanoate (PubChem CID 134956611) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is ethyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-3-phenylpropanoate.
| Compound Name | ethyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 134956611 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | ethyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Sc1ccc(C)cc1)[C@@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO2S/c1-3-27-24(26)23(28-21-16-14-18(2)15-17-21)22(19-10-6-4-7-11-19)25-20-12-8-5-9-13-20/h4-17,22-23,25H,3H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | NVHXASDGOOECNH-XZOQPEGZSA-N |
| XLogP | 5.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |