C22H24ClN3 — CID 134916199
6-(4-chlorophenyl)-3-cyclohexyl-4-(4-methylphenyl)-4H-triazine (PubChem CID 134916199) has the molecular formula C22H24ClN3 and a molecular weight of 365.91 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-cyclohexyl-4-(4-methylphenyl)-4H-triazine.
| Compound Name | 6-(4-chlorophenyl)-3-cyclohexyl-4-(4-methylphenyl)-4H-triazine |
|---|---|
| PubChem CID | 134916199 |
| Molecular Formula | C22H24ClN3 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 6-(4-chlorophenyl)-3-cyclohexyl-4-(4-methylphenyl)-4H-triazine |
| SMILES | Cc1ccc(C2C=C(c3ccc(Cl)cc3)N=NN2C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H24ClN3/c1-16-7-9-18(10-8-16)22-15-21(17-11-13-19(23)14-12-17)24-25-26(22)20-5-3-2-4-6-20/h7-15,20,22H,2-6H2,1H3 |
| InChIKey | OTPNSYZJANPAJB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |