C21H25N3 — CID 134916077
3-tert-butyl-4,6-bis(4-methylphenyl)-4H-triazine (PubChem CID 134916077) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-tert-butyl-4,6-bis(4-methylphenyl)-4H-triazine.
| Compound Name | 3-tert-butyl-4,6-bis(4-methylphenyl)-4H-triazine |
|---|---|
| PubChem CID | 134916077 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3-tert-butyl-4,6-bis(4-methylphenyl)-4H-triazine |
| SMILES | Cc1ccc(C2=CC(c3ccc(C)cc3)N(C(C)(C)C)N=N2)cc1 |
| InChI | InChI=1S/C21H25N3/c1-15-6-10-17(11-7-15)19-14-20(18-12-8-16(2)9-13-18)24(23-22-19)21(3,4)5/h6-14,20H,1-5H3 |
| InChIKey | XBBWHZYJQRIERH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |