C23H31NO4 — CID 134916714
(2R,3S,5S,8R,9S,10S,13S,14S)-17-acetyloxy-3-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid (PubChem CID 134916714) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (2R,3S,5S,8R,9S,10S,13S,14S)-17-acetyloxy-3-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid.
| Compound Name | (2R,3S,5S,8R,9S,10S,13S,14S)-17-acetyloxy-3-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 134916714 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2R,3S,5S,8R,9S,10S,13S,14S)-17-acetyloxy-3-cyano-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid |
| SMILES | CC(=O)OC1=CC[C@H]2[C@@H]3CC[C@H]4C[C@H](C#N)[C@H](C(=O)O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H31NO4/c1-13(25)28-20-7-6-18-16-5-4-15-10-14(12-24)17(21(26)27)11-23(15,3)19(16)8-9-22(18,20)2/h7,14-19H,4-6,8-11H2,1-3H3,(H,26,27)/t14-,15+,16+,17-,18+,19+,22+,23+/m1/s1 |
| InChIKey | UIBCSHSBXYNIDQ-HXEOZLSSSA-N |
| XLogP | 4.54 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |