C28H50O2Si — CID 134917075
(1S,3S,5S,8S,10S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-5-ol (PubChem CID 134917075) has the molecular formula C28H50O2Si and a molecular weight of 446.79 g/mol. Its IUPAC name is (1S,3S,5S,8S,10S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-5-ol.
| Compound Name | (1S,3S,5S,8S,10S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-5-ol |
|---|---|
| PubChem CID | 134917075 |
| Molecular Formula | C28H50O2Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (1S,3S,5S,8S,10S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-5-ol |
| SMILES | C=C1[C@H]2C[C@]3(C)CCC(C)=C([C@@H](O[Si](CC)(CC)C(C)C)C[C@]2(C)CC[C@@H]1O)C3(C)C |
| InChI | InChI=1S/C28H50O2Si/c1-11-31(12-2,19(3)4)30-24-18-27(9)15-14-23(29)21(6)22(27)17-28(10)16-13-20(5)25(24)26(28,7)8/h19,22-24,29H,6,11-18H2,1-5,7-10H3/t22-,23+,24+,27+,28+/m1/s1 |
| InChIKey | FDJKCHHWGGEJIV-FGEHTDNMSA-N |
| XLogP | 8.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|