About iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate
iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate (PubChem CID 134917605) has the molecular formula C28H26BF4IOPS-
and a molecular weight of 655.26 g/mol. Its IUPAC name is iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate.
Molecular Properties
| Compound Name | iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate |
| PubChem CID | 134917605 |
| Molecular Formula | C28H26BF4IOPS- |
| Molecular Weight | 655.26 g/mol |
| Exact Mass | 655.05 |
| IUPAC Name | iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate |
| SMILES | CO/C(=C(\SC)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C28H26IOPS.BF4/c1-30-27(23-15-7-3-8-16-23)28(32-2)31(29,24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26;2-1(3,4)5/h3-22H,1-2H3;/q;-1/b28-27-; |
| InChIKey | CUTWAECTNJCCIZ-LXCLTORNSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.26 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate?
The IUPAC name of iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate (CID 134917605) is iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate.
What is the SMILES notation for iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate?
The canonical SMILES for iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate is CO/C(=C(\SC)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate?
The InChIKey is CUTWAECTNJCCIZ-LXCLTORNSA-N. The full InChI is InChI=1S/C28H26IOPS.BF4/c1-30-27(23-15-7-3-8-16-23)28(32-2)31(29,24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26;2-1(3,4)5/h3-22H,1-2H3;/q;-1/b28-27-;.
What are the key properties of iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate?
iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate has a molecular weight of 655.26 g/mol, XLogP of 8.50, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodo-[(Z)-2-methoxy-1-methylsulfanyl-2-phenylethenyl]-triphenyl-λ5-phosphane tetrafluoroborate is sourced from PubChem (CID 134917605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).