C20H17BO3 — CID 67742343
1,2,2-triphenylethenoxyboronic acid (PubChem CID 67742343) has the molecular formula C20H17BO3 and a molecular weight of 316.17 g/mol. Its IUPAC name is 1,2,2-triphenylethenoxyboronic acid.
| Compound Name | 1,2,2-triphenylethenoxyboronic acid |
|---|---|
| PubChem CID | 67742343 |
| Molecular Formula | C20H17BO3 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1,2,2-triphenylethenoxyboronic acid |
| SMILES | OB(O)OC(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17BO3/c22-21(23)24-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,22-23H |
| InChIKey | DEKVZDSHDARFEK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|