C28H26O2Si — CID 10410016
dimethyl-phenoxy-(1,2,2-triphenylethenoxy)silane (PubChem CID 10410016) has the molecular formula C28H26O2Si and a molecular weight of 422.60 g/mol. Its IUPAC name is dimethyl-phenoxy-(1,2,2-triphenylethenoxy)silane.
| Compound Name | dimethyl-phenoxy-(1,2,2-triphenylethenoxy)silane |
|---|---|
| PubChem CID | 10410016 |
| Molecular Formula | C28H26O2Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | dimethyl-phenoxy-(1,2,2-triphenylethenoxy)silane |
| SMILES | C[Si](C)(OC(=C(c1ccccc1)c1ccccc1)c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C28H26O2Si/c1-31(2,29-26-21-13-6-14-22-26)30-28(25-19-11-5-12-20-25)27(23-15-7-3-8-16-23)24-17-9-4-10-18-24/h3-22H,1-2H3 |
| InChIKey | DHMQLYCTXHDCDN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|