C18H19NOSi — CID 12921434
3,3-diphenyl-2-trimethylsilyloxyprop-2-enenitrile (PubChem CID 12921434) has the molecular formula C18H19NOSi and a molecular weight of 293.44 g/mol. Its IUPAC name is 3,3-diphenyl-2-trimethylsilyloxyprop-2-enenitrile.
| Compound Name | 3,3-diphenyl-2-trimethylsilyloxyprop-2-enenitrile |
|---|---|
| PubChem CID | 12921434 |
| Molecular Formula | C18H19NOSi |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3,3-diphenyl-2-trimethylsilyloxyprop-2-enenitrile |
| SMILES | C[Si](C)(C)OC(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NOSi/c1-21(2,3)20-17(14-19)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,1-3H3 |
| InChIKey | CLDQSOFKBCVVNL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|