C16H26OSi2 — CID 102523679
trimethyl-(4-phenyl-4-trimethylsilylbuta-2,3-dien-2-yl)oxysilane (PubChem CID 102523679) has the molecular formula C16H26OSi2 and a molecular weight of 290.55 g/mol. Its IUPAC name is trimethyl-(4-phenyl-4-trimethylsilylbuta-2,3-dien-2-yl)oxysilane.
| Compound Name | trimethyl-(4-phenyl-4-trimethylsilylbuta-2,3-dien-2-yl)oxysilane |
|---|---|
| PubChem CID | 102523679 |
| Molecular Formula | C16H26OSi2 |
| Molecular Weight | 290.55 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | trimethyl-(4-phenyl-4-trimethylsilylbuta-2,3-dien-2-yl)oxysilane |
| SMILES | CC(=C=C(c1ccccc1)[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H26OSi2/c1-14(17-19(5,6)7)13-16(18(2,3)4)15-11-9-8-10-12-15/h8-12H,1-7H3 |
| InChIKey | GFHLKEYWLQIEIF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|