C12H14 — CID 10725633
4-methylpenta-2,3-dien-2-ylbenzene (PubChem CID 10725633) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-methylpenta-2,3-dien-2-ylbenzene.
| Compound Name | 4-methylpenta-2,3-dien-2-ylbenzene |
|---|---|
| PubChem CID | 10725633 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-methylpenta-2,3-dien-2-ylbenzene |
| SMILES | CC(C)=C=C(C)c1ccccc1 |
| InChI | InChI=1S/C12H14/c1-10(2)9-11(3)12-7-5-4-6-8-12/h4-8H,1-3H3 |
| InChIKey | XPBFGZJAMMGHJU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |