C17H24S — CID 142703752
4-propylsulfanylocta-2,3-dien-2-ylbenzene (PubChem CID 142703752) has the molecular formula C17H24S and a molecular weight of 260.45 g/mol. Its IUPAC name is 4-propylsulfanylocta-2,3-dien-2-ylbenzene.
| Compound Name | 4-propylsulfanylocta-2,3-dien-2-ylbenzene |
|---|---|
| PubChem CID | 142703752 |
| Molecular Formula | C17H24S |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-propylsulfanylocta-2,3-dien-2-ylbenzene |
| SMILES | CCCCC(=C=C(C)c1ccccc1)SCCC |
| InChI | InChI=1S/C17H24S/c1-4-6-12-17(18-13-5-2)14-15(3)16-10-8-7-9-11-16/h7-11H,4-6,12-13H2,1-3H3 |
| InChIKey | JGOHBJBXRAOJDO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |