C14H20SSi — CID 71323231
trimethyl-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)silane (PubChem CID 71323231) has the molecular formula C14H20SSi and a molecular weight of 248.47 g/mol. Its IUPAC name is trimethyl-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)silane.
| Compound Name | trimethyl-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)silane |
|---|---|
| PubChem CID | 71323231 |
| Molecular Formula | C14H20SSi |
| Molecular Weight | 248.47 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | trimethyl-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)silane |
| SMILES | CC(C)=C=C(Sc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H20SSi/c1-12(2)11-14(16(3,4)5)15-13-9-7-6-8-10-13/h6-10H,1-5H3 |
| InChIKey | IGFLDWCSJFRZHR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|