C9H5I3S — CID 86183087
1,3,3-triiodopropa-1,2-dienylsulfanylbenzene (PubChem CID 86183087) has the molecular formula C9H5I3S and a molecular weight of 525.92 g/mol. Its IUPAC name is 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene.
| Compound Name | 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene |
|---|---|
| PubChem CID | 86183087 |
| Molecular Formula | C9H5I3S |
| Molecular Weight | 525.92 g/mol |
| Exact Mass | 525.72 |
| IUPAC Name | 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene |
| SMILES | IC(I)=C=C(I)Sc1ccccc1 |
| InChI | InChI=1S/C9H5I3S/c10-8(11)6-9(12)13-7-4-2-1-3-5-7/h1-5H |
| InChIKey | DEFYEINPUWCFMN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|