About 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene
1,3,3-triiodopropa-1,2-dienylsulfanylbenzene (PubChem CID 86183087) has the molecular formula C9H5I3S
and a molecular weight of 525.92 g/mol. Its IUPAC name is 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene.
Molecular Properties
| Compound Name | 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene |
| PubChem CID | 86183087 |
| Molecular Formula | C9H5I3S |
| Molecular Weight | 525.92 g/mol |
| Exact Mass | 525.72 |
| IUPAC Name | 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene |
| SMILES | IC(I)=C=C(I)Sc1ccccc1 |
| InChI | InChI=1S/C9H5I3S/c10-8(11)6-9(12)13-7-4-2-1-3-5-7/h1-5H |
| InChIKey | DEFYEINPUWCFMN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene?
The IUPAC name of 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene (CID 86183087) is 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene.
What is the SMILES notation for 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene?
The canonical SMILES for 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene is IC(I)=C=C(I)Sc1ccccc1.
What is the InChIKey of 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene?
The InChIKey is DEFYEINPUWCFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5I3S/c10-8(11)6-9(12)13-7-4-2-1-3-5-7/h1-5H.
What are the key properties of 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene?
1,3,3-triiodopropa-1,2-dienylsulfanylbenzene has a molecular weight of 525.92 g/mol, XLogP of 5.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3-triiodopropa-1,2-dienylsulfanylbenzene is sourced from PubChem (CID 86183087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).