C12H16SSi — CID 10900155
trimethyl(1-phenylsulfanylpropa-1,2-dienyl)silane (PubChem CID 10900155) has the molecular formula C12H16SSi and a molecular weight of 220.41 g/mol. Its IUPAC name is trimethyl(1-phenylsulfanylpropa-1,2-dienyl)silane.
| Compound Name | trimethyl(1-phenylsulfanylpropa-1,2-dienyl)silane |
|---|---|
| PubChem CID | 10900155 |
| Molecular Formula | C12H16SSi |
| Molecular Weight | 220.41 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | trimethyl(1-phenylsulfanylpropa-1,2-dienyl)silane |
| SMILES | C=C=C(Sc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C12H16SSi/c1-5-12(14(2,3)4)13-11-9-7-6-8-10-11/h6-10H,1H2,2-4H3 |
| InChIKey | CLNKVICNDRBMRE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|