About (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene
(1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene (PubChem CID 15475138) has the molecular formula C13H17O3PS
and a molecular weight of 284.32 g/mol. Its IUPAC name is (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene.
Molecular Properties
| Compound Name | (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene |
| PubChem CID | 15475138 |
| Molecular Formula | C13H17O3PS |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene |
| SMILES | COP(=O)(OC)C(=C=C(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C13H17O3PS/c1-11(2)10-13(17(14,15-3)16-4)18-12-8-6-5-7-9-12/h5-9H,1-4H3 |
| InChIKey | ILNNCZSPTANMOO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene?
The IUPAC name of (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene (CID 15475138) is (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene.
What is the SMILES notation for (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene?
The canonical SMILES for (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene is COP(=O)(OC)C(=C=C(C)C)Sc1ccccc1.
What is the InChIKey of (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene?
The InChIKey is ILNNCZSPTANMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O3PS/c1-11(2)10-13(17(14,15-3)16-4)18-12-8-6-5-7-9-12/h5-9H,1-4H3.
What are the key properties of (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene?
(1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene has a molecular weight of 284.32 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-dimethoxyphosphoryl-3-methylbuta-1,2-dienyl)sulfanylbenzene is sourced from PubChem (CID 15475138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).