C33H38O — CID 102572876
(6E,9E)-2,5,5,11,11,14-hexamethyl-4,12-diphenylpentadeca-2,3,6,9,12,13-hexaen-8-one (PubChem CID 102572876) has the molecular formula C33H38O and a molecular weight of 450.67 g/mol. Its IUPAC name is (6E,9E)-2,5,5,11,11,14-hexamethyl-4,12-diphenylpentadeca-2,3,6,9,12,13-hexaen-8-one.
| Compound Name | (6E,9E)-2,5,5,11,11,14-hexamethyl-4,12-diphenylpentadeca-2,3,6,9,12,13-hexaen-8-one |
|---|---|
| PubChem CID | 102572876 |
| Molecular Formula | C33H38O |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | (6E,9E)-2,5,5,11,11,14-hexamethyl-4,12-diphenylpentadeca-2,3,6,9,12,13-hexaen-8-one |
| SMILES | CC(C)=C=C(c1ccccc1)C(C)(C)/C=C/C(=O)/C=C/C(C)(C)C(=C=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H38O/c1-25(2)23-30(27-15-11-9-12-16-27)32(5,6)21-19-29(34)20-22-33(7,8)31(24-26(3)4)28-17-13-10-14-18-28/h9-22H,1-8H3/b21-19+,22-20+ |
| InChIKey | HONBBZFEEUZZOD-FLFKKZLDSA-N |
| XLogP | 9.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|