C28H35NOSi2 — CID 12023313
(1Z)-1,4,4-triphenyl-N-trimethylsilyl-3-trimethylsilyloxybuta-1,3-dien-1-amine (PubChem CID 12023313) has the molecular formula C28H35NOSi2 and a molecular weight of 457.77 g/mol. Its IUPAC name is (1Z)-1,4,4-triphenyl-N-trimethylsilyl-3-trimethylsilyloxybuta-1,3-dien-1-amine.
| Compound Name | (1Z)-1,4,4-triphenyl-N-trimethylsilyl-3-trimethylsilyloxybuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 12023313 |
| Molecular Formula | C28H35NOSi2 |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (1Z)-1,4,4-triphenyl-N-trimethylsilyl-3-trimethylsilyloxybuta-1,3-dien-1-amine |
| SMILES | C[Si](C)(C)N/C(=C\C(O[Si](C)(C)C)=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35NOSi2/c1-31(2,3)29-26(23-16-10-7-11-17-23)22-27(30-32(4,5)6)28(24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-22,29H,1-6H3/b26-22- |
| InChIKey | IDPCXPUNKPSDJJ-ROMGYVFFSA-N |
| XLogP | 7.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|