C21H28OSi2 — CID 101122048
dimethyl-phenyl-[(1Z)-3-phenyl-1-trimethylsilyloxybuta-1,3-dienyl]silane (PubChem CID 101122048) has the molecular formula C21H28OSi2 and a molecular weight of 352.63 g/mol. Its IUPAC name is dimethyl-phenyl-[(1Z)-3-phenyl-1-trimethylsilyloxybuta-1,3-dienyl]silane.
| Compound Name | dimethyl-phenyl-[(1Z)-3-phenyl-1-trimethylsilyloxybuta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 101122048 |
| Molecular Formula | C21H28OSi2 |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | dimethyl-phenyl-[(1Z)-3-phenyl-1-trimethylsilyloxybuta-1,3-dienyl]silane |
| SMILES | C=C(/C=C(/O[Si](C)(C)C)[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28OSi2/c1-18(19-13-9-7-10-14-19)17-21(22-23(2,3)4)24(5,6)20-15-11-8-12-16-20/h7-17H,1H2,2-6H3/b21-17- |
| InChIKey | LWGXJMHEXIZLOW-FXBPSFAMSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|