C15H22O2Si — CID 177433215
[(1Z)-1-ethoxy-3-phenylbuta-1,3-dienoxy]-trimethylsilane (PubChem CID 177433215) has the molecular formula C15H22O2Si and a molecular weight of 262.42 g/mol. Its IUPAC name is [(1Z)-1-ethoxy-3-phenylbuta-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(1Z)-1-ethoxy-3-phenylbuta-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 177433215 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [(1Z)-1-ethoxy-3-phenylbuta-1,3-dienoxy]-trimethylsilane |
| SMILES | C=C(/C=C(/OCC)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H22O2Si/c1-6-16-15(17-18(3,4)5)12-13(2)14-10-8-7-9-11-14/h7-12H,2,6H2,1,3-5H3/b15-12- |
| InChIKey | XFFCOHMFCRUTGX-QINSGFPZSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|