C19H32O3Si2 — CID 177460627
[(1Z,3E)-1-ethoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane (PubChem CID 177460627) has the molecular formula C19H32O3Si2 and a molecular weight of 364.63 g/mol. Its IUPAC name is [(1Z,3E)-1-ethoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(1Z,3E)-1-ethoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 177460627 |
| Molecular Formula | C19H32O3Si2 |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(1Z,3E)-1-ethoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane |
| SMILES | CCO/C(=C/C(=C\c1ccc(C)cc1)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H32O3Si2/c1-9-20-19(22-24(6,7)8)15-18(21-23(3,4)5)14-17-12-10-16(2)11-13-17/h10-15H,9H2,1-8H3/b18-14+,19-15- |
| InChIKey | QAOMMXQBYJYURV-CBSGOVTASA-N |
| XLogP | 5.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|