About methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate
methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate (PubChem CID 134976900) has the molecular formula C23H24IPS2
and a molecular weight of 522.46 g/mol. Its IUPAC name is methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate.
Molecular Properties
| Compound Name | methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate |
| PubChem CID | 134976900 |
| Molecular Formula | C23H24IPS2 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate |
| SMILES | CSC(=S)C(C)(C)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24IPS2/c1-23(2,22(26)27-3)25(24,19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3 |
| InChIKey | FYADUQIZZAYKFU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate?
The IUPAC name of methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate (CID 134976900) is methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate.
What is the SMILES notation for methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate?
The canonical SMILES for methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate is CSC(=S)C(C)(C)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate?
The InChIKey is FYADUQIZZAYKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24IPS2/c1-23(2,22(26)27-3)25(24,19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3.
What are the key properties of methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate?
methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate has a molecular weight of 522.46 g/mol, XLogP of 6.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropanedithioate is sourced from PubChem (CID 134976900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).