C23H27INP — CID 134884379
N-[iodo(triphenyl)-λ5-phosphanyl]-N,2-dimethylpropan-2-amine (PubChem CID 134884379) has the molecular formula C23H27INP and a molecular weight of 475.35 g/mol. Its IUPAC name is N-[iodo(triphenyl)-λ5-phosphanyl]-N,2-dimethylpropan-2-amine.
| Compound Name | N-[iodo(triphenyl)-λ5-phosphanyl]-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 134884379 |
| Molecular Formula | C23H27INP |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[iodo(triphenyl)-λ5-phosphanyl]-N,2-dimethylpropan-2-amine |
| SMILES | CN(C(C)(C)C)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27INP/c1-23(2,3)25(4)26(24,20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,1-4H3 |
| InChIKey | OESWUPIOYGZCSU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|