C23H42N2 — CID 132599756
N,N,N',N'-tetratert-butyl-1-phenylmethanediamine (PubChem CID 132599756) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is N,N,N',N'-tetratert-butyl-1-phenylmethanediamine.
| Compound Name | N,N,N',N'-tetratert-butyl-1-phenylmethanediamine |
|---|---|
| PubChem CID | 132599756 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | N,N,N',N'-tetratert-butyl-1-phenylmethanediamine |
| SMILES | CC(C)(C)N(C(c1ccccc1)N(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H42N2/c1-20(2,3)24(21(4,5)6)19(18-16-14-13-15-17-18)25(22(7,8)9)23(10,11)12/h13-17,19H,1-12H3 |
| InChIKey | LNKMMDVLHHEZNE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|