About 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol
2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol (PubChem CID 134976890) has the molecular formula C28H28BrOP
and a molecular weight of 491.41 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol |
| PubChem CID | 134976890 |
| Molecular Formula | C28H28BrOP |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol |
| SMILES | CC(C)(C(O)c1ccccc1)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28BrOP/c1-28(2,27(30)23-15-7-3-8-16-23)31(29,24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27,30H,1-2H3 |
| InChIKey | HVLMUNUSURXAQP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol?
The IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol (CID 134976890) is 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol.
What is the SMILES notation for 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol?
The canonical SMILES for 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol is CC(C)(C(O)c1ccccc1)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol?
The InChIKey is HVLMUNUSURXAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28BrOP/c1-28(2,27(30)23-15-7-3-8-16-23)31(29,24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27,30H,1-2H3.
What are the key properties of 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol?
2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol has a molecular weight of 491.41 g/mol, XLogP of 6.34, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo(triphenyl)-λ5-phosphanyl]-2-methyl-1-phenylpropan-1-ol is sourced from PubChem (CID 134976890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).