C27H26BrOP — CID 13214001
(1R,2R)-2-[bromo(triphenyl)-lambda5-phosphanyl]-1-phenylpropan-1-ol (PubChem CID 13214001) has the molecular formula C27H26BrOP and a molecular weight of 477.38 g/mol. Its IUPAC name is (1R,2R)-2-[bromo(triphenyl)-lambda5-phosphanyl]-1-phenylpropan-1-ol.
| Compound Name | (1R,2R)-2-[bromo(triphenyl)-lambda5-phosphanyl]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 13214001 |
| Molecular Formula | C27H26BrOP |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | (1R,2R)-2-[bromo(triphenyl)-lambda5-phosphanyl]-1-phenylpropan-1-ol |
| SMILES | C[C@H]([C@H](O)c1ccccc1)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26BrOP/c1-22(27(29)23-14-6-2-7-15-23)30(28,24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-22,27,29H,1H3/t22-,27+/m1/s1 |
| InChIKey | RNMNWYSPIWKRHZ-AMGIVPHBSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|