About ethane;trihydroxy(diphenyl)-λ5-phosphane
ethane;trihydroxy(diphenyl)-λ5-phosphane (PubChem CID 159842008) has the molecular formula C14H19O3P
and a molecular weight of 266.28 g/mol. Its IUPAC name is ethane;trihydroxy(diphenyl)-λ5-phosphane.
Molecular Properties
| Compound Name | ethane;trihydroxy(diphenyl)-λ5-phosphane |
| PubChem CID | 159842008 |
| Molecular Formula | C14H19O3P |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethane;trihydroxy(diphenyl)-λ5-phosphane |
| SMILES | CC.OP(O)(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H13O3P.C2H6/c13-16(14,15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10,13-15H;1-2H3 |
| InChIKey | NOUJMYVHRYZPKT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;trihydroxy(diphenyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;trihydroxy(diphenyl)-λ5-phosphane?
The IUPAC name of ethane;trihydroxy(diphenyl)-λ5-phosphane (CID 159842008) is ethane;trihydroxy(diphenyl)-λ5-phosphane.
What is the SMILES notation for ethane;trihydroxy(diphenyl)-λ5-phosphane?
The canonical SMILES for ethane;trihydroxy(diphenyl)-λ5-phosphane is CC.OP(O)(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethane;trihydroxy(diphenyl)-λ5-phosphane?
The InChIKey is NOUJMYVHRYZPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13O3P.C2H6/c13-16(14,15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2/h1-10,13-15H;1-2H3.
What are the key properties of ethane;trihydroxy(diphenyl)-λ5-phosphane?
ethane;trihydroxy(diphenyl)-λ5-phosphane has a molecular weight of 266.28 g/mol, XLogP of 1.94, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;trihydroxy(diphenyl)-λ5-phosphane is sourced from PubChem (CID 159842008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).