About bromo-methyl-triphenyl-λ5-phosphane;hydrobromide
bromo-methyl-triphenyl-λ5-phosphane;hydrobromide (PubChem CID 173269490) has the molecular formula C19H19Br2P
and a molecular weight of 438.14 g/mol. Its IUPAC name is bromo-methyl-triphenyl-λ5-phosphane;hydrobromide.
Molecular Properties
| Compound Name | bromo-methyl-triphenyl-λ5-phosphane;hydrobromide |
| PubChem CID | 173269490 |
| Molecular Formula | C19H19Br2P |
| Molecular Weight | 438.14 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | bromo-methyl-triphenyl-λ5-phosphane;hydrobromide |
| SMILES | Br.CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18BrP.BrH/c1-21(20,17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H |
| InChIKey | LUQNHJQDSBWDOM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromo-methyl-triphenyl-λ5-phosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-methyl-triphenyl-λ5-phosphane;hydrobromide?
The IUPAC name of bromo-methyl-triphenyl-λ5-phosphane;hydrobromide (CID 173269490) is bromo-methyl-triphenyl-λ5-phosphane;hydrobromide.
What is the SMILES notation for bromo-methyl-triphenyl-λ5-phosphane;hydrobromide?
The canonical SMILES for bromo-methyl-triphenyl-λ5-phosphane;hydrobromide is Br.CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of bromo-methyl-triphenyl-λ5-phosphane;hydrobromide?
The InChIKey is LUQNHJQDSBWDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrP.BrH/c1-21(20,17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H.
What are the key properties of bromo-methyl-triphenyl-λ5-phosphane;hydrobromide?
bromo-methyl-triphenyl-λ5-phosphane;hydrobromide has a molecular weight of 438.14 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-methyl-triphenyl-λ5-phosphane;hydrobromide is sourced from PubChem (CID 173269490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).