About gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide
gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide (PubChem CID 13222343) has the molecular formula C21H18AuN2P
and a molecular weight of 526.33 g/mol. Its IUPAC name is gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide.
Molecular Properties
| Compound Name | gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide |
| PubChem CID | 13222343 |
| Molecular Formula | C21H18AuN2P |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide |
| SMILES | CP(C#N)(c1ccccc1)(c1ccccc1)c1ccccc1.[Au+].[C-]#N |
| InChI | InChI=1S/C20H18NP.CN.Au/c1-22(17-21,18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;1-2;/h2-16H,1H3;;/q;-1;+1 |
| InChIKey | OMJVHNHXYICCDO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide?
The IUPAC name of gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide (CID 13222343) is gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide.
What is the SMILES notation for gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide?
The canonical SMILES for gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide is CP(C#N)(c1ccccc1)(c1ccccc1)c1ccccc1.[Au+].[C-]#N.
What is the InChIKey of gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide?
The InChIKey is OMJVHNHXYICCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18NP.CN.Au/c1-22(17-21,18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;1-2;/h2-16H,1H3;;/q;-1;+1.
What are the key properties of gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide?
gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide has a molecular weight of 526.33 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);[methyl(triphenyl)-λ5-phosphanyl]formonitrile;cyanide is sourced from PubChem (CID 13222343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).