C17H23NO4S — CID 134917710
N-[(1R,3aS,8aR)-3-oxo-1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-1-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 134917710) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[(1R,3aS,8aR)-3-oxo-1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-1-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1R,3aS,8aR)-3-oxo-1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-1-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134917710 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[(1R,3aS,8aR)-3-oxo-1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-1-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@H]2OC(=O)[C@H]3CCCCC[C@H]32)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-12-8-10-13(11-9-12)23(20,21)18(2)16-14-6-4-3-5-7-15(14)17(19)22-16/h8-11,14-16H,3-7H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | BWAMFYJFWZFKNX-OWCLPIDISA-N |
| XLogP | 2.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |